Products 2851454-18-5
CAS 2851454-18-5 is the registry number for 3-Phenyl-9-(2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)-9H-carbazole, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g.
3-phenyl-9-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbazole (CAS 2851454-18-5) is a chemical compound with the molecular formula C30H28BNO2 and a molecular weight of 445.4 g/mol. IUPAC name: 3-phenyl-9-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbazole. InChIKey: PVUFOXNWDGZVSN-UHFFFAOYSA-N.
| Molecular formula | C30H28BNO2 |
|---|---|
| Molecular weight | 445.4 g/mol |
| IUPAC name | 3-phenyl-9-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbazole |
| InChIKey | PVUFOXNWDGZVSN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2N3C4=C(C=C(C=C4)C5=CC=CC=C5)C6=CC=CC=C63 |
Computed by PubChem (NCBI)