CAS 2853570-55-3 is the registry number for 3-[(3-Bromophenyl)(4-methyl-4H-1,2,4-triazol-3-yl)methyl]cyclobutanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-[(3-bromophenyl)-(4-methyl-1,2,4-triazol-3-yl)methyl]cyclobutan-1-one (CAS 2853570-55-3) is a chemical compound with the molecular formula C14H14BrN3O and a molecular weight of 320.18 g/mol. IUPAC name: 3-[(3-bromophenyl)-(4-methyl-1,2,4-triazol-3-yl)methyl]cyclobutan-1-one. InChIKey: ARSDCYBDTDGFIB-UHFFFAOYSA-N.
| Molecular formula | C14H14BrN3O |
|---|---|
| Molecular weight | 320.18 g/mol |
| IUPAC name | 3-[(3-bromophenyl)-(4-methyl-1,2,4-triazol-3-yl)methyl]cyclobutan-1-one |
| InChIKey | ARSDCYBDTDGFIB-UHFFFAOYSA-N |
| SMILES | CN1C=NN=C1C(C2CC(=O)C2)C3=CC(=CC=C3)Br |
Computed by PubChem (NCBI)