Products 2863657-38-7
CAS 2863657-38-7 is the registry number for (S)-1-(1H-Pyrazol-3-yl)ethan-1-amine dihydrochloride, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(1S)-1-(1H-pyrazol-5-yl)ethanamine;dihydrochloride (CAS 2863657-38-7) is a chemical compound with the molecular formula C5H11Cl2N3 and a molecular weight of 184.06 g/mol. IUPAC name: (1S)-1-(1H-pyrazol-5-yl)ethanamine;dihydrochloride. InChIKey: MEWRIHSHGPNYSX-FHNDMYTFSA-N.
| Molecular formula | C5H11Cl2N3 |
|---|---|
| Molecular weight | 184.06 g/mol |
| IUPAC name | (1S)-1-(1H-pyrazol-5-yl)ethanamine;dihydrochloride |
| InChIKey | MEWRIHSHGPNYSX-FHNDMYTFSA-N |
| SMILES | C[C@@H](C1=CC=NN1)N.Cl.Cl |
Computed by PubChem (NCBI)