Products 2864378-67-4
CAS 2864378-67-4 is the registry number for 1,1-DIMETHYLETHYL 3-(2,4,6-TRIMETHYLBENZOYL)-3,8-DIAZABICYCLO[3.2.1]OCTANE-8-CARBOXYLATE, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 3-(2,4,6-trimethylbenzoyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylate (CAS 2864378-67-4) is a chemical compound with the molecular formula C21H30N2O3 and a molecular weight of 358.5 g/mol. IUPAC name: tert-butyl 3-(2,4,6-trimethylbenzoyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylate. InChIKey: NMLDOVFYRLPIQJ-UHFFFAOYSA-N.
| Molecular formula | C21H30N2O3 |
|---|---|
| Molecular weight | 358.5 g/mol |
| IUPAC name | tert-butyl 3-(2,4,6-trimethylbenzoyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
| InChIKey | NMLDOVFYRLPIQJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C(=O)N2CC3CCC(C2)N3C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)