CAS 2875046-31-2 appears in our catalog under these names: (R,R)–VVD–118313, (R,R)-VVD-118313, 99%, 99%, (R,R)-VVD-118313, 99.34%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 5mg, 1mg, 5 mg, 10 mg, 1 mg.
1-[(3R)-3-(3,4-dichlorophenyl)piperidin-1-yl]-3-[(3R)-1-methylsulfonylpyrrolidin-3-yl]prop-2-yn-1-one (CAS 2875046-31-2) is a chemical compound with the molecular formula C19H22Cl2N2O3S and a molecular weight of 429.4 g/mol. IUPAC name: 1-[(3R)-3-(3,4-dichlorophenyl)piperidin-1-yl]-3-[(3R)-1-methylsulfonylpyrrolidin-3-yl]prop-2-yn-1-one. InChIKey: OUPVMVHXMWBFDP-HOCLYGCPSA-N.
| Molecular formula | C19H22Cl2N2O3S |
|---|---|
| Molecular weight | 429.4 g/mol |
| IUPAC name | 1-[(3R)-3-(3,4-dichlorophenyl)piperidin-1-yl]-3-[(3R)-1-methylsulfonylpyrrolidin-3-yl]prop-2-yn-1-one |
| InChIKey | OUPVMVHXMWBFDP-HOCLYGCPSA-N |
| SMILES | CS(=O)(=O)N1CC[C@@H](C1)C#CC(=O)N2CCC[C@@H](C2)C3=CC(=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)