CAS 2880294-95-9 is the registry number for 4-(2-Anthracenyl)pyridine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-anthracen-2-ylpyridine (CAS 2880294-95-9) is a chemical compound with the molecular formula C19H13N and a molecular weight of 255.3 g/mol. IUPAC name: 4-anthracen-2-ylpyridine. InChIKey: ZCTDAPFMFNSJQI-UHFFFAOYSA-N.
| Molecular formula | C19H13N |
|---|---|
| Molecular weight | 255.3 g/mol |
| IUPAC name | 4-anthracen-2-ylpyridine |
| InChIKey | ZCTDAPFMFNSJQI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C3C=C(C=CC3=CC2=C1)C4=CC=NC=C4 |
Computed by PubChem (NCBI)