Products 2882839-26-9
CAS 2882839-26-9 is the registry number for 4',5'-bis(3,4-dihydroxyphenyl)-[1,1':2',1''-terphenyl]-3,3'',4,4''-tetraol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-[2,4,5-tris(3,4-dihydroxyphenyl)phenyl]benzene-1,2-diol (CAS 2882839-26-9) is a chemical compound with the molecular formula C30H22O8 and a molecular weight of 510.5 g/mol. IUPAC name: 4-[2,4,5-tris(3,4-dihydroxyphenyl)phenyl]benzene-1,2-diol. InChIKey: SSEMONOKUMIRKB-UHFFFAOYSA-N.
| Molecular formula | C30H22O8 |
|---|---|
| Molecular weight | 510.5 g/mol |
| IUPAC name | 4-[2,4,5-tris(3,4-dihydroxyphenyl)phenyl]benzene-1,2-diol |
| InChIKey | SSEMONOKUMIRKB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CC(=C(C=C2C3=CC(=C(C=C3)O)O)C4=CC(=C(C=C4)O)O)C5=CC(=C(C=C5)O)O)O)O |
Computed by PubChem (NCBI)