CAS 2883044-82-2 is the registry number for 3-fluoro-1-(oxan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
3-fluoro-1-(oxan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole (CAS 2883044-82-2) is a chemical compound with the molecular formula C18H24BFN2O3 and a molecular weight of 346.2 g/mol. IUPAC name: 3-fluoro-1-(oxan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole. InChIKey: PAKBATFXNLJVCH-UHFFFAOYSA-N.
| Molecular formula | C18H24BFN2O3 |
|---|---|
| Molecular weight | 346.2 g/mol |
| IUPAC name | 3-fluoro-1-(oxan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
| InChIKey | PAKBATFXNLJVCH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)N(N=C3F)C4CCCCO4 |
Computed by PubChem (NCBI)