Products 2883408-35-1
CAS 2883408-35-1 is the registry number for TMV-IN-3. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-[3-[4-[(E)-3-(3-methylphenyl)prop-2-enoyl]phenoxy]propoxy]-2,3-dihydroinden-1-one (CAS 2883408-35-1) is a chemical compound with the molecular formula C28H26O4 and a molecular weight of 426.5 g/mol. IUPAC name: 5-[3-[4-[(E)-3-(3-methylphenyl)prop-2-enoyl]phenoxy]propoxy]-2,3-dihydroinden-1-one. InChIKey: NEMQTDLSAUJPDF-MKMNVTDBSA-N.
| Molecular formula | C28H26O4 |
|---|---|
| Molecular weight | 426.5 g/mol |
| IUPAC name | 5-[3-[4-[(E)-3-(3-methylphenyl)prop-2-enoyl]phenoxy]propoxy]-2,3-dihydroinden-1-one |
| InChIKey | NEMQTDLSAUJPDF-MKMNVTDBSA-N |
| SMILES | CC1=CC(=CC=C1)/C=C/C(=O)C2=CC=C(C=C2)OCCCOC3=CC4=C(C=C3)C(=O)CC4 |
Computed by PubChem (NCBI)