Products 2883770-96-3
CAS 2883770-96-3 is the registry number for Rel-methyl (3R,7aS)-3-(hydroxymethyl)tetrahydro-1H-pyrrolizine-7a(5H)-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (3R,8S)-3-(hydroxymethyl)-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylate (CAS 2883770-96-3) is a chemical compound with the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. IUPAC name: methyl (3R,8S)-3-(hydroxymethyl)-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylate. InChIKey: OPKRTCCJBWHLAU-SCZZXKLOSA-N.
| Molecular formula | C10H17NO3 |
|---|---|
| Molecular weight | 199.25 g/mol |
| IUPAC name | methyl (3R,8S)-3-(hydroxymethyl)-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylate |
| InChIKey | OPKRTCCJBWHLAU-SCZZXKLOSA-N |
| SMILES | COC(=O)[C@@]12CCCN1[C@H](CC2)CO |
Computed by PubChem (NCBI)