Products 2888607-83-6
CAS 2888607-83-6 is the registry number for tert-Butyl 2-(3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 2-[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate (CAS 2888607-83-6) is a chemical compound with the molecular formula C19H29BO4 and a molecular weight of 332.2 g/mol. IUPAC name: tert-butyl 2-[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate. InChIKey: DLMTWSYJBHXDOF-UHFFFAOYSA-N.
| Molecular formula | C19H29BO4 |
|---|---|
| Molecular weight | 332.2 g/mol |
| IUPAC name | tert-butyl 2-[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate |
| InChIKey | DLMTWSYJBHXDOF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)CC(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)