Products 2891574-93-7
CAS 2891574-93-7 is the registry number for EF-4-177. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[2-(6-cyano-1H-indol-3-yl)ethylamino]-5-(pentafluoro-lambda6-sulfanyl)benzoic acid (CAS 2891574-93-7) is a chemical compound with the molecular formula C18H14F5N3O2S and a molecular weight of 431.4 g/mol. IUPAC name: 2-[2-(6-cyano-1H-indol-3-yl)ethylamino]-5-(pentafluoro-lambda6-sulfanyl)benzoic acid. InChIKey: DODVGTHDEMMYPW-UHFFFAOYSA-N.
| Molecular formula | C18H14F5N3O2S |
|---|---|
| Molecular weight | 431.4 g/mol |
| IUPAC name | 2-[2-(6-cyano-1H-indol-3-yl)ethylamino]-5-(pentafluoro-lambda6-sulfanyl)benzoic acid |
| InChIKey | DODVGTHDEMMYPW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C#N)NC=C2CCNC3=C(C=C(C=C3)S(F)(F)(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)