Products 2902652-34-8
CAS 2902652-34-8 is the registry number for 1-[4-(2,6-Dioxopiperidin-3-yl)-2,6-difluorophenyl]piperidine-4-carbaldehyde, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-[4-(2,6-dioxopiperidin-3-yl)-2,6-difluorophenyl]piperidine-4-carbaldehyde (CAS 2902652-34-8) is a chemical compound with the molecular formula C17H18F2N2O3 and a molecular weight of 336.33 g/mol. IUPAC name: 1-[4-(2,6-dioxopiperidin-3-yl)-2,6-difluorophenyl]piperidine-4-carbaldehyde. InChIKey: IMVRZZRHGSZJBA-UHFFFAOYSA-N.
| Molecular formula | C17H18F2N2O3 |
|---|---|
| Molecular weight | 336.33 g/mol |
| IUPAC name | 1-[4-(2,6-dioxopiperidin-3-yl)-2,6-difluorophenyl]piperidine-4-carbaldehyde |
| InChIKey | IMVRZZRHGSZJBA-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1C2=CC(=C(C(=C2)F)N3CCC(CC3)C=O)F |
Computed by PubChem (NCBI)