CAS 2918928-18-2 is the registry number for 2,6-dibromo-4-pentylphenol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,6-dibromo-4-pentylphenol (CAS 2918928-18-2) is a chemical compound with the molecular formula C11H14Br2O and a molecular weight of 322.04 g/mol. IUPAC name: 2,6-dibromo-4-pentylphenol. InChIKey: VOXQPWGWQCTENY-UHFFFAOYSA-N.
| Molecular formula | C11H14Br2O |
|---|---|
| Molecular weight | 322.04 g/mol |
| IUPAC name | 2,6-dibromo-4-pentylphenol |
| InChIKey | VOXQPWGWQCTENY-UHFFFAOYSA-N |
| SMILES | CCCCCC1=CC(=C(C(=C1)Br)O)Br |
Computed by PubChem (NCBI)