CAS 2919851-73-1 is the registry number for CVN417, 99.93%. Offered by: MedChemExpress. Available pack sizes: 10mM/1mL, 100 mg, 10 mg, 25 mg, 5 mg, 50 mg.
5-(2-chloro-4-methoxyphenyl)-1-methyl-N-[(3S)-1-methylpiperidin-3-yl]pyrazole-3-carboxamide (CAS 2919851-73-1) is a chemical compound with the molecular formula C18H23ClN4O2 and a molecular weight of 362.9 g/mol. IUPAC name: 5-(2-chloro-4-methoxyphenyl)-1-methyl-N-[(3S)-1-methylpiperidin-3-yl]pyrazole-3-carboxamide. InChIKey: QLOHOGRMRUDDPM-LBPRGKRZSA-N.
| Molecular formula | C18H23ClN4O2 |
|---|---|
| Molecular weight | 362.9 g/mol |
| IUPAC name | 5-(2-chloro-4-methoxyphenyl)-1-methyl-N-[(3S)-1-methylpiperidin-3-yl]pyrazole-3-carboxamide |
| InChIKey | QLOHOGRMRUDDPM-LBPRGKRZSA-N |
| SMILES | CN1CCC[C@@H](C1)NC(=O)C2=NN(C(=C2)C3=C(C=C(C=C3)OC)Cl)C |
Computed by PubChem (NCBI)