Products 2920232-94-4
CAS 2920232-94-4 is the registry number for (2R,3R)-2-methylazetidine-3-carbonitrile hydrochloride, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
(2R,3R)-2-methylazetidine-3-carbonitrile;hydrochloride (CAS 2920232-94-4) is a chemical compound with the molecular formula C5H9ClN2 and a molecular weight of 132.59 g/mol. IUPAC name: (2R,3R)-2-methylazetidine-3-carbonitrile;hydrochloride. InChIKey: VWHFVCOSDXJTMD-TYSVMGFPSA-N.
| Molecular formula | C5H9ClN2 |
|---|---|
| Molecular weight | 132.59 g/mol |
| IUPAC name | (2R,3R)-2-methylazetidine-3-carbonitrile;hydrochloride |
| InChIKey | VWHFVCOSDXJTMD-TYSVMGFPSA-N |
| SMILES | C[C@@H]1[C@@H](CN1)C#N.Cl |
Computed by PubChem (NCBI)