Products 2920404-61-9

CAS 2920404-61-9 is the registry number for 2-hydroxyspiro[3.3]heptane-2-carboxylic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

2-hydroxyspiro[3.3]heptane-2-carboxylic acid (CAS 2920404-61-9) is a chemical compound with the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. IUPAC name: 2-hydroxyspiro[3.3]heptane-2-carboxylic acid. InChIKey: ABMRLEVFESKPCP-UHFFFAOYSA-N.

Identity
Molecular formulaC8H12O3
Molecular weight156.18 g/mol
IUPAC name2-hydroxyspiro[3.3]heptane-2-carboxylic acid
InChIKeyABMRLEVFESKPCP-UHFFFAOYSA-N
SMILESC1CC2(C1)CC(C2)(C(=O)O)O

Computed by PubChem (NCBI)