CAS 292065-64-6 is the registry number for TDRL-X80, 99.6%. Offered by: MedChemExpress. Available pack sizes: 1 mg, 5 mg.
5-[5-[(Z)-[1-(3-carboxyphenyl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]furan-2-yl]-2-chlorobenzoic acid (CAS 292065-64-6) is a chemical compound with the molecular formula C23H15ClN2O6 and a molecular weight of 450.8 g/mol. IUPAC name: 5-[5-[(Z)-[1-(3-carboxyphenyl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]furan-2-yl]-2-chlorobenzoic acid. InChIKey: XZRBYOCWWJMJRZ-BOPFTXTBSA-N.
| Molecular formula | C23H15ClN2O6 |
|---|---|
| Molecular weight | 450.8 g/mol |
| IUPAC name | 5-[5-[(Z)-[1-(3-carboxyphenyl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]furan-2-yl]-2-chlorobenzoic acid |
| InChIKey | XZRBYOCWWJMJRZ-BOPFTXTBSA-N |
| SMILES | CC\1=NN(C(=O)/C1=C\C2=CC=C(O2)C3=CC(=C(C=C3)Cl)C(=O)O)C4=CC=CC(=C4)C(=O)O |
Computed by PubChem (NCBI)