Products 2921948-27-6
CAS 2921948-27-6 is the registry number for HDAC-IN-53, 95.73%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 50 mg, 10 mg, 1 mg, 5 mg.
5-amino-N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]-2-(2-chlorophenyl)triazole-4-carboxamide (CAS 2921948-27-6) is a chemical compound with the molecular formula C23H20ClN7O2 and a molecular weight of 461.9 g/mol. IUPAC name: 5-amino-N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]-2-(2-chlorophenyl)triazole-4-carboxamide. InChIKey: BPVZRJLWWCCMKG-UHFFFAOYSA-N.
| Molecular formula | C23H20ClN7O2 |
|---|---|
| Molecular weight | 461.9 g/mol |
| IUPAC name | 5-amino-N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]-2-(2-chlorophenyl)triazole-4-carboxamide |
| InChIKey | BPVZRJLWWCCMKG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N)NC(=O)C2=CC=C(C=C2)CNC(=O)C3=NN(N=C3N)C4=CC=CC=C4Cl |
Computed by PubChem (NCBI)