CAS 2924064-35-5 is the registry number for (2,2-Difluorobenzo[d][1,3]dioxol-5-yl)(piperazin-1-yl)methanone hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g, 25g.
(2,2-difluoro-1,3-benzodioxol-5-yl)-piperazin-1-ylmethanone;hydrochloride (CAS 2924064-35-5) is a chemical compound with the molecular formula C12H13ClF2N2O3 and a molecular weight of 306.69 g/mol. IUPAC name: (2,2-difluoro-1,3-benzodioxol-5-yl)-piperazin-1-ylmethanone;hydrochloride. InChIKey: HGIQFROQWRNQCX-UHFFFAOYSA-N.
| Molecular formula | C12H13ClF2N2O3 |
|---|---|
| Molecular weight | 306.69 g/mol |
| IUPAC name | (2,2-difluoro-1,3-benzodioxol-5-yl)-piperazin-1-ylmethanone;hydrochloride |
| InChIKey | HGIQFROQWRNQCX-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C(=O)C2=CC3=C(C=C2)OC(O3)(F)F.Cl |
Computed by PubChem (NCBI)