CAS 2924153-63-7 is the registry number for Ethyl 2-(1,1-difluoroethyl)-4-(((trifluoromethyl)sulfonyl)oxy)thiazole-5-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-(1,1-difluoroethyl)-4-(trifluoromethylsulfonyloxy)-1,3-thiazole-5-carboxylate (CAS 2924153-63-7) is a chemical compound with the molecular formula C9H8F5NO5S2 and a molecular weight of 369.3 g/mol. IUPAC name: ethyl 2-(1,1-difluoroethyl)-4-(trifluoromethylsulfonyloxy)-1,3-thiazole-5-carboxylate. InChIKey: ZSHIYKZYAWXNKC-UHFFFAOYSA-N.
| Molecular formula | C9H8F5NO5S2 |
|---|---|
| Molecular weight | 369.3 g/mol |
| IUPAC name | ethyl 2-(1,1-difluoroethyl)-4-(trifluoromethylsulfonyloxy)-1,3-thiazole-5-carboxylate |
| InChIKey | ZSHIYKZYAWXNKC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(S1)C(C)(F)F)OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)