Products 2924824-57-5
CAS 2924824-57-5 is the registry number for Methyl 4-chloro-2-((2,4-dimethoxybenzyl)amino)-3-methylquinoline-6-carboxylate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 4-chloro-2-[(2,4-dimethoxyphenyl)methylamino]-3-methylquinoline-6-carboxylate (CAS 2924824-57-5) is a chemical compound with the molecular formula C21H21ClN2O4 and a molecular weight of 400.9 g/mol. IUPAC name: methyl 4-chloro-2-[(2,4-dimethoxyphenyl)methylamino]-3-methylquinoline-6-carboxylate. InChIKey: WZEVSIDVVBOWOR-UHFFFAOYSA-N.
| Molecular formula | C21H21ClN2O4 |
|---|---|
| Molecular weight | 400.9 g/mol |
| IUPAC name | methyl 4-chloro-2-[(2,4-dimethoxyphenyl)methylamino]-3-methylquinoline-6-carboxylate |
| InChIKey | WZEVSIDVVBOWOR-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=CC(=C2)C(=O)OC)N=C1NCC3=C(C=C(C=C3)OC)OC)Cl |
Computed by PubChem (NCBI)