Products 2925088-53-3
CAS 2925088-53-3 is the registry number for 3-{7-bromo-[1,2,4]triazolo[4,3-a]pyridin-3-yl}piperidine-2,6-dione, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g, 100mg, 250mg, 500mg.
3-(7-bromo-[1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidine-2,6-dione (CAS 2925088-53-3) is a chemical compound with the molecular formula C11H9BrN4O2 and a molecular weight of 309.12 g/mol. IUPAC name: 3-(7-bromo-[1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidine-2,6-dione. InChIKey: PVIMATHCTWQMAW-UHFFFAOYSA-N.
| Molecular formula | C11H9BrN4O2 |
|---|---|
| Molecular weight | 309.12 g/mol |
| IUPAC name | 3-(7-bromo-[1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidine-2,6-dione |
| InChIKey | PVIMATHCTWQMAW-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1C2=NN=C3N2C=CC(=C3)Br |
Computed by PubChem (NCBI)