CAS 2925159-10-8 is the registry number for tert-Butyl (S)-4-((trifluoromethoxy)methyl)-1,2,3-oxathiazolidine-3-carboxylate 2,2-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (4S)-2,2-dioxo-4-(trifluoromethoxymethyl)oxathiazolidine-3-carboxylate (CAS 2925159-10-8) is a chemical compound with the molecular formula C9H14F3NO6S and a molecular weight of 321.27 g/mol. IUPAC name: tert-butyl (4S)-2,2-dioxo-4-(trifluoromethoxymethyl)oxathiazolidine-3-carboxylate. InChIKey: RMTKOQYOGDJRIJ-LURJTMIESA-N.
| Molecular formula | C9H14F3NO6S |
|---|---|
| Molecular weight | 321.27 g/mol |
| IUPAC name | tert-butyl (4S)-2,2-dioxo-4-(trifluoromethoxymethyl)oxathiazolidine-3-carboxylate |
| InChIKey | RMTKOQYOGDJRIJ-LURJTMIESA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@H](COS1(=O)=O)COC(F)(F)F |
Computed by PubChem (NCBI)