CAS 2925159-11-9 is the registry number for tert-Butyl (S)-4-(2,2-difluoroethyl)-1,2,3-oxathiazolidine-3-carboxylate 2,2-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (4S)-4-(2,2-difluoroethyl)-2,2-dioxooxathiazolidine-3-carboxylate (CAS 2925159-11-9) is a chemical compound with the molecular formula C9H15F2NO5S and a molecular weight of 287.28 g/mol. IUPAC name: tert-butyl (4S)-4-(2,2-difluoroethyl)-2,2-dioxooxathiazolidine-3-carboxylate. InChIKey: SVGQTTRDKFDHQR-LURJTMIESA-N.
| Molecular formula | C9H15F2NO5S |
|---|---|
| Molecular weight | 287.28 g/mol |
| IUPAC name | tert-butyl (4S)-4-(2,2-difluoroethyl)-2,2-dioxooxathiazolidine-3-carboxylate |
| InChIKey | SVGQTTRDKFDHQR-LURJTMIESA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@H](COS1(=O)=O)CC(F)F |
Computed by PubChem (NCBI)