Products 2930044-84-9
CAS 2930044-84-9 is the registry number for 2,4-dimethoxy-6-methyl-pyridine-3-sulfonyl chloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g, 25g.
2,4-dimethoxy-6-methylpyridine-3-sulfonyl chloride (CAS 2930044-84-9) is a chemical compound with the molecular formula C8H10ClNO4S and a molecular weight of 251.69 g/mol. IUPAC name: 2,4-dimethoxy-6-methylpyridine-3-sulfonyl chloride. InChIKey: WIMANWTWRZBSCI-UHFFFAOYSA-N.
| Molecular formula | C8H10ClNO4S |
|---|---|
| Molecular weight | 251.69 g/mol |
| IUPAC name | 2,4-dimethoxy-6-methylpyridine-3-sulfonyl chloride |
| InChIKey | WIMANWTWRZBSCI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=N1)OC)S(=O)(=O)Cl)OC |
Computed by PubChem (NCBI)