Products 2938997-09-0
CAS 2938997-09-0 is the registry number for N-Benzyl-2-(2-chloroethyl)thiazole-4-carboxamide, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
N-benzyl-2-(2-chloroethyl)-1,3-thiazole-4-carboxamide (CAS 2938997-09-0) is a chemical compound with the molecular formula C13H13ClN2OS and a molecular weight of 280.77 g/mol. IUPAC name: N-benzyl-2-(2-chloroethyl)-1,3-thiazole-4-carboxamide. InChIKey: CBASUZASKZPEBN-UHFFFAOYSA-N.
| Molecular formula | C13H13ClN2OS |
|---|---|
| Molecular weight | 280.77 g/mol |
| IUPAC name | N-benzyl-2-(2-chloroethyl)-1,3-thiazole-4-carboxamide |
| InChIKey | CBASUZASKZPEBN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC(=O)C2=CSC(=N2)CCCl |
Computed by PubChem (NCBI)