Products 2938997-20-5
CAS 2938997-20-5 is the registry number for 3-(4-Fluorophenyl)-3-oxo-2-(pyridazin-4-yl)propanenitrile, 95%. Offered by: Chemat. Available pack sizes: 100mg.
3-(4-fluorophenyl)-3-oxo-2-pyridazin-4-ylpropanenitrile (CAS 2938997-20-5) is a chemical compound with the molecular formula C13H8FN3O and a molecular weight of 241.22 g/mol. IUPAC name: 3-(4-fluorophenyl)-3-oxo-2-pyridazin-4-ylpropanenitrile. InChIKey: YNUFJYLXZKPGND-UHFFFAOYSA-N.
| Molecular formula | C13H8FN3O |
|---|---|
| Molecular weight | 241.22 g/mol |
| IUPAC name | 3-(4-fluorophenyl)-3-oxo-2-pyridazin-4-ylpropanenitrile |
| InChIKey | YNUFJYLXZKPGND-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C(C#N)C2=CN=NC=C2)F |
Computed by PubChem (NCBI)