CAS 2939814-40-9 is the registry number for Benzyl (S)-2-(aminomethyl)pyrrolidine-1-carboxylate hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Benzyl (2S)-2-(aminomethyl)pyrrolidine-1-carboxylate;hydrochloride (CAS 2939814-40-9) is a chemical compound with the molecular formula C13H19ClN2O2 and a molecular weight of 270.75 g/mol. IUPAC name: benzyl (2S)-2-(aminomethyl)pyrrolidine-1-carboxylate;hydrochloride. InChIKey: ONODQZLASNRARN-YDALLXLXSA-N.
| Molecular formula | C13H19ClN2O2 |
|---|---|
| Molecular weight | 270.75 g/mol |
| IUPAC name | benzyl (2S)-2-(aminomethyl)pyrrolidine-1-carboxylate;hydrochloride |
| InChIKey | ONODQZLASNRARN-YDALLXLXSA-N |
| SMILES | C1C[C@H](N(C1)C(=O)OCC2=CC=CC=C2)CN.Cl |
Computed by PubChem (NCBI)