Products 2940858-93-3
CAS 2940858-93-3 is the registry number for 3-[[(3R)-1,1-dioxothiolan-3-yl]amino]propanoic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
3-[[(3R)-1,1-dioxothiolan-3-yl]amino]propanoic acid (CAS 2940858-93-3) is a chemical compound with the molecular formula C7H13NO4S and a molecular weight of 207.25 g/mol. IUPAC name: 3-[[(3R)-1,1-dioxothiolan-3-yl]amino]propanoic acid. InChIKey: IKVXZBQFTASZSZ-ZCFIWIBFSA-N.
| Molecular formula | C7H13NO4S |
|---|---|
| Molecular weight | 207.25 g/mol |
| IUPAC name | 3-[[(3R)-1,1-dioxothiolan-3-yl]amino]propanoic acid |
| InChIKey | IKVXZBQFTASZSZ-ZCFIWIBFSA-N |
| SMILES | C1CS(=O)(=O)C[C@@H]1NCCC(=O)O |
Computed by PubChem (NCBI)