Products 2940938-67-8
CAS 2940938-67-8 is the registry number for N-(4-chloro-2,3,5,6-tetradeuterio-phenyl)acetamide, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
N-(4-chloro-2,3,5,6-tetradeuteriophenyl)acetamide (CAS 2940938-67-8) is a chemical compound with the molecular formula C8H8ClNO and a molecular weight of 173.63 g/mol. IUPAC name: N-(4-chloro-2,3,5,6-tetradeuteriophenyl)acetamide. InChIKey: GGUOCFNAWIODMF-QFFDRWTDSA-N.
| Molecular formula | C8H8ClNO |
|---|---|
| Molecular weight | 173.63 g/mol |
| IUPAC name | N-(4-chloro-2,3,5,6-tetradeuteriophenyl)acetamide |
| InChIKey | GGUOCFNAWIODMF-QFFDRWTDSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1NC(=O)C)[2H])[2H])Cl)[2H] |
Computed by PubChem (NCBI)