Products 2940944-49-8
CAS 2940944-49-8 is the registry number for 4-methyl-2-nitro-5-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)phenol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
4-methyl-2-nitro-5-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)phenol (CAS 2940944-49-8) is a chemical compound with the molecular formula C13H10N4O4 and a molecular weight of 286.24 g/mol. IUPAC name: 4-methyl-2-nitro-5-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)phenol. InChIKey: PKKYGZFVJXFLNI-UHFFFAOYSA-N.
| Molecular formula | C13H10N4O4 |
|---|---|
| Molecular weight | 286.24 g/mol |
| IUPAC name | 4-methyl-2-nitro-5-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)phenol |
| InChIKey | PKKYGZFVJXFLNI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1OC2=CC3=NC=NN3C=C2)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)