Products 2940964-16-7

CAS 2940964-16-7 is the registry number for tert-Butyl 7-amino-1-azaspiro[3.5]nonane-1-carboxylate dioxalate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

Bis(tert-butyl 7-amino-1-azaspiro[3.5]nonane-1-carboxylate);oxalic acid (CAS 2940964-16-7) is a chemical compound with the molecular formula C28H50N4O8 and a molecular weight of 570.7 g/mol. IUPAC name: bis(tert-butyl 7-amino-1-azaspiro[3.5]nonane-1-carboxylate);oxalic acid. InChIKey: HQJNSDWARPTSKX-UHFFFAOYSA-N.

Identity
Molecular formulaC28H50N4O8
Molecular weight570.7 g/mol
IUPAC namebis(tert-butyl 7-amino-1-azaspiro[3.5]nonane-1-carboxylate);oxalic acid
InChIKeyHQJNSDWARPTSKX-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC12CCC(CC2)N.CC(C)(C)OC(=O)N1CCC12CCC(CC2)N.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)