Products 2944100-30-3
CAS 2944100-30-3 is the registry number for HSP90-IN-23, 98.25%. Offered by: MedChemExpress. Available pack sizes: 50 mg, 10 mg, 5 mg, 100 mg, 25 mg.
5-(2,4-dihydroxy-5-propan-2-ylphenyl)-N-ethyl-4-(4-methylsulfonylphenyl)-1,2-oxazole-3-carboxamide (CAS 2944100-30-3) is a chemical compound with the molecular formula C22H24N2O6S and a molecular weight of 444.5 g/mol. IUPAC name: 5-(2,4-dihydroxy-5-propan-2-ylphenyl)-N-ethyl-4-(4-methylsulfonylphenyl)-1,2-oxazole-3-carboxamide. InChIKey: FRBAUKMBFQDKJI-UHFFFAOYSA-N.
| Molecular formula | C22H24N2O6S |
|---|---|
| Molecular weight | 444.5 g/mol |
| IUPAC name | 5-(2,4-dihydroxy-5-propan-2-ylphenyl)-N-ethyl-4-(4-methylsulfonylphenyl)-1,2-oxazole-3-carboxamide |
| InChIKey | FRBAUKMBFQDKJI-UHFFFAOYSA-N |
| SMILES | CCNC(=O)C1=NOC(=C1C2=CC=C(C=C2)S(=O)(=O)C)C3=CC(=C(C=C3O)O)C(C)C |
Computed by PubChem (NCBI)