CAS 2945911-70-4 is the registry number for 4-Nitrophenyl [2-[3-[(Prop-2-yn-1-yloxy)methyl]-3H-diazirin-3-yl]ethyl] Carbonate, >95.0%(HPLC). Offered by: TCI. Available pack sizes: 100mg.
(4-nitrophenyl) 2-[3-(prop-2-ynoxymethyl)diazirin-3-yl]ethyl carbonate (CAS 2945911-70-4) is a chemical compound with the molecular formula C14H13N3O6 and a molecular weight of 319.27 g/mol. IUPAC name: (4-nitrophenyl) 2-[3-(prop-2-ynoxymethyl)diazirin-3-yl]ethyl carbonate. InChIKey: VUOSTHHYRMMRCB-UHFFFAOYSA-N.
| Molecular formula | C14H13N3O6 |
|---|---|
| Molecular weight | 319.27 g/mol |
| IUPAC name | (4-nitrophenyl) 2-[3-(prop-2-ynoxymethyl)diazirin-3-yl]ethyl carbonate |
| InChIKey | VUOSTHHYRMMRCB-UHFFFAOYSA-N |
| SMILES | C#CCOCC1(N=N1)CCOC(=O)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)