Products 2945911-70-4

CAS 2945911-70-4 is the registry number for 4-Nitrophenyl [2-[3-[(Prop-2-yn-1-yloxy)methyl]-3H-diazirin-3-yl]ethyl] Carbonate, >95.0%(HPLC). Offered by: TCI. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

(4-nitrophenyl) 2-[3-(prop-2-ynoxymethyl)diazirin-3-yl]ethyl carbonate (CAS 2945911-70-4) is a chemical compound with the molecular formula C14H13N3O6 and a molecular weight of 319.27 g/mol. IUPAC name: (4-nitrophenyl) 2-[3-(prop-2-ynoxymethyl)diazirin-3-yl]ethyl carbonate. InChIKey: VUOSTHHYRMMRCB-UHFFFAOYSA-N.

Identity
Molecular formulaC14H13N3O6
Molecular weight319.27 g/mol
IUPAC name(4-nitrophenyl) 2-[3-(prop-2-ynoxymethyl)diazirin-3-yl]ethyl carbonate
InChIKeyVUOSTHHYRMMRCB-UHFFFAOYSA-N
SMILESC#CCOCC1(N=N1)CCOC(=O)OC2=CC=C(C=C2)[N+](=O)[O-]

Computed by PubChem (NCBI)