Products 294881-47-3
CAS 294881-47-3 is the registry number for 1-Bromo-6-phenylpyrene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
1-bromo-6-phenylpyrene (CAS 294881-47-3) is a chemical compound with the molecular formula C22H13Br and a molecular weight of 357.2 g/mol. IUPAC name: 1-bromo-6-phenylpyrene. InChIKey: UHPILNVIPDIPLG-UHFFFAOYSA-N.
| Molecular formula | C22H13Br |
|---|---|
| Molecular weight | 357.2 g/mol |
| IUPAC name | 1-bromo-6-phenylpyrene |
| InChIKey | UHPILNVIPDIPLG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C3C=CC4=C5C3=C(C=C2)C=CC5=C(C=C4)Br |
Computed by PubChem (NCBI)