Products 2952779-17-6
CAS 2952779-17-6 is the registry number for β-catenin-IN-7. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-bromo-N-(4-pyridin-2-ylphenyl)benzenesulfonamide (CAS 2952779-17-6) is a chemical compound with the molecular formula C17H13BrN2O2S and a molecular weight of 389.3 g/mol. IUPAC name: 4-bromo-N-(4-pyridin-2-ylphenyl)benzenesulfonamide. InChIKey: RNTHZJWNDRBXRY-UHFFFAOYSA-N.
| Molecular formula | C17H13BrN2O2S |
|---|---|
| Molecular weight | 389.3 g/mol |
| IUPAC name | 4-bromo-N-(4-pyridin-2-ylphenyl)benzenesulfonamide |
| InChIKey | RNTHZJWNDRBXRY-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CC=C(C=C2)NS(=O)(=O)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)