Products 2954727-27-4
CAS 2954727-27-4 is the registry number for (1S,2S)-2-(Dibenzylamino)cyclobutan-1-ol, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Trans-(1S,2S)-2-(dibenzylamino)cyclobutan-1-ol (CAS 2954727-27-4) is a chemical compound with the molecular formula C18H21NO and a molecular weight of 267.4 g/mol. IUPAC name: trans-(1S,2S)-2-(dibenzylamino)cyclobutan-1-ol. InChIKey: KZHPUOOVICRESI-ROUUACIJSA-N.
| Molecular formula | C18H21NO |
|---|---|
| Molecular weight | 267.4 g/mol |
| IUPAC name | trans-(1S,2S)-2-(dibenzylamino)cyclobutan-1-ol |
| InChIKey | KZHPUOOVICRESI-ROUUACIJSA-N |
| SMILES | C1C[C@@H]([C@H]1N(CC2=CC=CC=C2)CC3=CC=CC=C3)O |
Computed by PubChem (NCBI)