Products 2956426-18-7
CAS 2956426-18-7 is the registry number for MAO-B-IN-21. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-(5-chloro-2-hydroxyphenyl)-2-(1-heptyl-3-oxo-1H-2-benzofuran-5-yl)-1H-pyrazol-3-one (CAS 2956426-18-7) is a chemical compound with the molecular formula C24H25ClN2O4 and a molecular weight of 440.9 g/mol. IUPAC name: 5-(5-chloro-2-hydroxyphenyl)-2-(1-heptyl-3-oxo-1H-2-benzofuran-5-yl)-1H-pyrazol-3-one. InChIKey: CSGCUKIUVYJPNI-UHFFFAOYSA-N.
| Molecular formula | C24H25ClN2O4 |
|---|---|
| Molecular weight | 440.9 g/mol |
| IUPAC name | 5-(5-chloro-2-hydroxyphenyl)-2-(1-heptyl-3-oxo-1H-2-benzofuran-5-yl)-1H-pyrazol-3-one |
| InChIKey | CSGCUKIUVYJPNI-UHFFFAOYSA-N |
| SMILES | CCCCCCCC1C2=C(C=C(C=C2)N3C(=O)C=C(N3)C4=C(C=CC(=C4)Cl)O)C(=O)O1 |
Computed by PubChem (NCBI)