Products 2969393-31-3
CAS 2969393-31-3 is the registry number for 2,4-dichloro-1-((2-methylbenzyl)oxy)benzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,4-dichloro-1-[(2-methylphenyl)methoxy]benzene (CAS 2969393-31-3) is a chemical compound with the molecular formula C14H12Cl2O and a molecular weight of 267.1 g/mol. IUPAC name: 2,4-dichloro-1-[(2-methylphenyl)methoxy]benzene. InChIKey: PUOFQUPKIFVASP-UHFFFAOYSA-N.
| Molecular formula | C14H12Cl2O |
|---|---|
| Molecular weight | 267.1 g/mol |
| IUPAC name | 2,4-dichloro-1-[(2-methylphenyl)methoxy]benzene |
| InChIKey | PUOFQUPKIFVASP-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1COC2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)