CAS 29764-44-1 is the registry number for 4-Isopropyl-4'-vinyl-1,1'-biphenyl, 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 25mg, 50mg, 100mg.
1-ethenyl-4-(4-propan-2-ylphenyl)benzene (CAS 29764-44-1) is a chemical compound with the molecular formula C17H18 and a molecular weight of 222.32 g/mol. IUPAC name: 1-ethenyl-4-(4-propan-2-ylphenyl)benzene. InChIKey: TVNDHHFKNWPDQT-UHFFFAOYSA-N.
| Molecular formula | C17H18 |
|---|---|
| Molecular weight | 222.32 g/mol |
| IUPAC name | 1-ethenyl-4-(4-propan-2-ylphenyl)benzene |
| InChIKey | TVNDHHFKNWPDQT-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)C2=CC=C(C=C2)C=C |
Computed by PubChem (NCBI)