Products 2983059-63-6

CAS 2983059-63-6 is the registry number for 2-oxabicyclo[2.1.1]hexan-4-ylmethyl acetate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-oxabicyclo[2.1.1]hexan-4-ylmethyl acetate (CAS 2983059-63-6) is a chemical compound with the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. IUPAC name: 2-oxabicyclo[2.1.1]hexan-4-ylmethyl acetate. InChIKey: ASAQDDNHEZQMFS-UHFFFAOYSA-N.

Identity
Molecular formulaC8H12O3
Molecular weight156.18 g/mol
IUPAC name2-oxabicyclo[2.1.1]hexan-4-ylmethyl acetate
InChIKeyASAQDDNHEZQMFS-UHFFFAOYSA-N
SMILESCC(=O)OCC12CC(C1)OC2

Computed by PubChem (NCBI)