Products 2983060-73-5
CAS 2983060-73-5 is the registry number for 3-(5-bromo-2H-1,2,3-benzotriazol-2-yl)piperidine-2,6-dione, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
3-(5-bromobenzotriazol-2-yl)piperidine-2,6-dione (CAS 2983060-73-5) is a chemical compound with the molecular formula C11H9BrN4O2 and a molecular weight of 309.12 g/mol. IUPAC name: 3-(5-bromobenzotriazol-2-yl)piperidine-2,6-dione. InChIKey: KBBOUORYUHCLQP-UHFFFAOYSA-N.
| Molecular formula | C11H9BrN4O2 |
|---|---|
| Molecular weight | 309.12 g/mol |
| IUPAC name | 3-(5-bromobenzotriazol-2-yl)piperidine-2,6-dione |
| InChIKey | KBBOUORYUHCLQP-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2N=C3C=CC(=CC3=N2)Br |
Computed by PubChem (NCBI)