Products 2983117-36-6
CAS 2983117-36-6 is the registry number for FABP4-IN-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-[3-chloro-2-(2,3-dihydro-1-benzofuran-5-yl)phenyl]-2-(trifluoromethyl)benzoic acid (CAS 2983117-36-6) is a chemical compound with the molecular formula C22H14ClF3O3 and a molecular weight of 418.8 g/mol. IUPAC name: 5-[3-chloro-2-(2,3-dihydro-1-benzofuran-5-yl)phenyl]-2-(trifluoromethyl)benzoic acid. InChIKey: INLIHUCZNWEXGG-UHFFFAOYSA-N.
| Molecular formula | C22H14ClF3O3 |
|---|---|
| Molecular weight | 418.8 g/mol |
| IUPAC name | 5-[3-chloro-2-(2,3-dihydro-1-benzofuran-5-yl)phenyl]-2-(trifluoromethyl)benzoic acid |
| InChIKey | INLIHUCZNWEXGG-UHFFFAOYSA-N |
| SMILES | C1COC2=C1C=C(C=C2)C3=C(C=CC=C3Cl)C4=CC(=C(C=C4)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)