Products 2983137-28-4
CAS 2983137-28-4 is the registry number for 3-Chloro-1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole, 98%. Offered by: Fluorochem. Available pack sizes: 250mg, 1g, 5g.
3-chloro-1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 2983137-28-4) is a chemical compound with the molecular formula C10H16BClN2O2 and a molecular weight of 242.51 g/mol. IUPAC name: 3-chloro-1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: GSFAHBJIKBEOGR-UHFFFAOYSA-N.
| Molecular formula | C10H16BClN2O2 |
|---|---|
| Molecular weight | 242.51 g/mol |
| IUPAC name | 3-chloro-1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | GSFAHBJIKBEOGR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2Cl)C |
Computed by PubChem (NCBI)