Products 2988849-20-1
CAS 2988849-20-1 is the registry number for LJ-4517. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R,3S,4S)-2-(6-amino-2-hex-1-ynyl-8-thiophen-2-ylpurin-9-yl)oxolane-3,4-diol (CAS 2988849-20-1) is a chemical compound with the molecular formula C19H21N5O3S and a molecular weight of 399.5 g/mol. IUPAC name: (2R,3S,4S)-2-(6-amino-2-hex-1-ynyl-8-thiophen-2-ylpurin-9-yl)oxolane-3,4-diol. InChIKey: MUHXGASCCALSAJ-SGJUXQJHSA-N.
| Molecular formula | C19H21N5O3S |
|---|---|
| Molecular weight | 399.5 g/mol |
| IUPAC name | (2R,3S,4S)-2-(6-amino-2-hex-1-ynyl-8-thiophen-2-ylpurin-9-yl)oxolane-3,4-diol |
| InChIKey | MUHXGASCCALSAJ-SGJUXQJHSA-N |
| SMILES | CCCCC#CC1=NC(=C2C(=N1)N(C(=N2)C3=CC=CS3)[C@H]4[C@H]([C@H](CO4)O)O)N |
Computed by PubChem (NCBI)