Products 2991234-54-7
CAS 2991234-54-7 is the registry number for Cyclopenta[c]pyrrole-2(1H)-carboxylic acid, 5-formylhexahydro-, 1,1-dimethylethyl ester, (3aR,6aS)-rel-, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl (3aR,6aS)-5-formyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate (CAS 2991234-54-7) is a chemical compound with the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. IUPAC name: tert-butyl (3aR,6aS)-5-formyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate. InChIKey: IAUYRDUQIWSCOC-FGWVZKOKSA-N.
| Molecular formula | C13H21NO3 |
|---|---|
| Molecular weight | 239.31 g/mol |
| IUPAC name | tert-butyl (3aR,6aS)-5-formyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate |
| InChIKey | IAUYRDUQIWSCOC-FGWVZKOKSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2CC(C[C@H]2C1)C=O |
Computed by PubChem (NCBI)