CAS 2991427-09-7 appears in our catalog under these names: HDAC6–IN–23, HDAC6-IN-23, 99.61%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 5 mg, 25 mg, 10 mg.
2-(difluoromethyl)-5-[6-[(5-pyridin-2-yltetrazol-2-yl)methyl]-3-pyridinyl]-1,3,4-oxadiazole (CAS 2991427-09-7) is a chemical compound with the molecular formula C15H10F2N8O and a molecular weight of 356.29 g/mol. IUPAC name: 2-(difluoromethyl)-5-[6-[(5-pyridin-2-yltetrazol-2-yl)methyl]-3-pyridinyl]-1,3,4-oxadiazole. InChIKey: ZTVLPDLCENUSAG-UHFFFAOYSA-N.
| Molecular formula | C15H10F2N8O |
|---|---|
| Molecular weight | 356.29 g/mol |
| IUPAC name | 2-(difluoromethyl)-5-[6-[(5-pyridin-2-yltetrazol-2-yl)methyl]-3-pyridinyl]-1,3,4-oxadiazole |
| InChIKey | ZTVLPDLCENUSAG-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=NN(N=N2)CC3=NC=C(C=C3)C4=NN=C(O4)C(F)F |
Computed by PubChem (NCBI)