CAS 2995274-47-8 is the registry number for 3-Fluoro-10-methyl-11-oxo-10,11-dihydrodibenzo[b,f][1,4]thiazepine-8-carboxylic acid 5-oxide, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
9-fluoro-5-methyl-6,11-dioxobenzo[b][1,4]benzothiazepine-3-carboxylic acid (CAS 2995274-47-8) is a chemical compound with the molecular formula C15H10FNO4S and a molecular weight of 319.3 g/mol. IUPAC name: 9-fluoro-5-methyl-6,11-dioxobenzo[b][1,4]benzothiazepine-3-carboxylic acid. InChIKey: UYTTWUYHBOUIPH-UHFFFAOYSA-N.
| Molecular formula | C15H10FNO4S |
|---|---|
| Molecular weight | 319.3 g/mol |
| IUPAC name | 9-fluoro-5-methyl-6,11-dioxobenzo[b][1,4]benzothiazepine-3-carboxylic acid |
| InChIKey | UYTTWUYHBOUIPH-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC(=C2)C(=O)O)S(=O)C3=C(C1=O)C=CC(=C3)F |
Computed by PubChem (NCBI)