CAS 2996217-13-9 is the registry number for 2-(2-CHLORO-4-NITROPHENYL)-1-[4-(1-METHYLETHYL)-1-PIPERAZINYL]ETHANONE, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(2-chloro-4-nitrophenyl)-1-(4-propan-2-ylpiperazin-1-yl)ethanone (CAS 2996217-13-9) is a chemical compound with the molecular formula C15H20ClN3O3 and a molecular weight of 325.79 g/mol. IUPAC name: 2-(2-chloro-4-nitrophenyl)-1-(4-propan-2-ylpiperazin-1-yl)ethanone. InChIKey: QRLGSVULQUADNU-UHFFFAOYSA-N.
| Molecular formula | C15H20ClN3O3 |
|---|---|
| Molecular weight | 325.79 g/mol |
| IUPAC name | 2-(2-chloro-4-nitrophenyl)-1-(4-propan-2-ylpiperazin-1-yl)ethanone |
| InChIKey | QRLGSVULQUADNU-UHFFFAOYSA-N |
| SMILES | CC(C)N1CCN(CC1)C(=O)CC2=C(C=C(C=C2)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)